C14H31NO3S — CID 116759105
5-ethoxy-N-ethyl-1-ethylsulfonyl-5-methylheptan-4-amine (PubChem CID 116759105) has the molecular formula C14H31NO3S and a molecular weight of 293.47 g/mol. Its IUPAC name is 5-ethoxy-N-ethyl-1-ethylsulfonyl-5-methylheptan-4-amine.
| Compound Name | 5-ethoxy-N-ethyl-1-ethylsulfonyl-5-methylheptan-4-amine |
|---|---|
| PubChem CID | 116759105 |
| Molecular Formula | C14H31NO3S |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 5-ethoxy-N-ethyl-1-ethylsulfonyl-5-methylheptan-4-amine |
| SMILES | CCNC(CCCS(=O)(=O)CC)C(C)(CC)OCC |
| InChI | InChI=1S/C14H31NO3S/c1-6-14(5,18-8-3)13(15-7-2)11-10-12-19(16,17)9-4/h13,15H,6-12H2,1-5H3 |
| InChIKey | YYECLVGUFPHRDI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |