C18H11N5OS3 — CID 11675912
1-phenyl-5-sulfanylidene-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)-4H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 11675912) has the molecular formula C18H11N5OS3 and a molecular weight of 409.52 g/mol. Its IUPAC name is 1-phenyl-5-sulfanylidene-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)-4H-pyrazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 1-phenyl-5-sulfanylidene-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)-4H-pyrazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 11675912 |
| Molecular Formula | C18H11N5OS3 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 1-phenyl-5-sulfanylidene-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)-4H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c(-c3nc(-c4cccs4)cs3)nn(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H11N5OS3/c24-16-15-13(20-18(25)21-16)14(22-23(15)10-5-2-1-3-6-10)17-19-11(9-27-17)12-7-4-8-26-12/h1-9H,(H2,20,21,24,25) |
| InChIKey | NJZVQLOXMOHLAW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|