C27H17N7O2S2 — CID 11627993
12-acetyl-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-2-one (PubChem CID 11627993) has the molecular formula C27H17N7O2S2 and a molecular weight of 535.61 g/mol. Its IUPAC name is 12-acetyl-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-2-one.
| Compound Name | 12-acetyl-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-2-one |
|---|---|
| PubChem CID | 11627993 |
| Molecular Formula | C27H17N7O2S2 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 12-acetyl-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraen-2-one |
| SMILES | CC(=O)c1nn(-c2ccccc2)c2nc3c(-c4nc(-c5cccs5)cs4)nn(-c4ccccc4)c3c(=O)n12 |
| InChI | InChI=1S/C27H17N7O2S2/c1-16(35)24-31-34(18-11-6-3-7-12-18)27-29-21-22(25-28-19(15-38-25)20-13-8-14-37-20)30-33(17-9-4-2-5-10-17)23(21)26(36)32(24)27/h2-15H,1H3 |
| InChIKey | LDNXQVOFPBRPEW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 99.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |