C28H19N7O3S2 — CID 11721072
ethyl 2-oxo-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraene-12-carboxylate (PubChem CID 11721072) has the molecular formula C28H19N7O3S2 and a molecular weight of 565.64 g/mol. Its IUPAC name is ethyl 2-oxo-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraene-12-carboxylate.
| Compound Name | ethyl 2-oxo-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 11721072 |
| Molecular Formula | C28H19N7O3S2 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.10 |
| IUPAC Name | ethyl 2-oxo-4,10-diphenyl-6-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1,4,5,8,10,11-hexazatricyclo[7.3.0.03,7]dodeca-3(7),5,8,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c2nc3c(-c4nc(-c5cccs5)cs4)nn(-c4ccccc4)c3c(=O)n12 |
| InChI | InChI=1S/C28H19N7O3S2/c1-2-38-27(37)24-32-35(18-12-7-4-8-13-18)28-30-21-22(25-29-19(16-40-25)20-14-9-15-39-20)31-34(17-10-5-3-6-11-17)23(21)26(36)33(24)28/h3-16H,2H2,1H3 |
| InChIKey | CEKIAYWBCOFNPT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 109.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |