About 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine
5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine (PubChem CID 116759842) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine.
Molecular Properties
| Compound Name | 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine |
| PubChem CID | 116759842 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine |
| SMILES | C=C(C)CC(NC)C(CC)(CC)OCC |
| InChI | InChI=1S/C13H27NO/c1-7-13(8-2,15-9-3)12(14-6)10-11(4)5/h12,14H,4,7-10H2,1-3,5-6H3 |
| InChIKey | KQIWONJLJIKJTO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine?
The IUPAC name of 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine (CID 116759842) is 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine.
What is the SMILES notation for 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine?
The canonical SMILES for 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine is C=C(C)CC(NC)C(CC)(CC)OCC.
What is the InChIKey of 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine?
The InChIKey is KQIWONJLJIKJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-7-13(8-2,15-9-3)12(14-6)10-11(4)5/h12,14H,4,7-10H2,1-3,5-6H3.
What are the key properties of 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine?
5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine has a molecular weight of 213.36 g/mol, XLogP of 3.14, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-5-ethyl-N,2-dimethylhept-1-en-4-amine is sourced from PubChem (CID 116759842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).