C15H33NO — CID 116760023
3-ethoxy-3-ethyl-N,8-dimethylnonan-4-amine (PubChem CID 116760023) has the molecular formula C15H33NO and a molecular weight of 243.44 g/mol. Its IUPAC name is 3-ethoxy-3-ethyl-N,8-dimethylnonan-4-amine.
| Compound Name | 3-ethoxy-3-ethyl-N,8-dimethylnonan-4-amine |
|---|---|
| PubChem CID | 116760023 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 3-ethoxy-3-ethyl-N,8-dimethylnonan-4-amine |
| SMILES | CCOC(CC)(CC)C(CCCC(C)C)NC |
| InChI | InChI=1S/C15H33NO/c1-7-15(8-2,17-9-3)14(16-6)12-10-11-13(4)5/h13-14,16H,7-12H2,1-6H3 |
| InChIKey | UCFMCSHQISLWMO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |