C12H20BrNOS — CID 116760824
1-(3-bromothiophen-2-yl)-2-ethyl-2-methoxy-N-methylbutan-1-amine (PubChem CID 116760824) has the molecular formula C12H20BrNOS and a molecular weight of 306.27 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-2-ethyl-2-methoxy-N-methylbutan-1-amine.
| Compound Name | 1-(3-bromothiophen-2-yl)-2-ethyl-2-methoxy-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 116760824 |
| Molecular Formula | C12H20BrNOS |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-2-ethyl-2-methoxy-N-methylbutan-1-amine |
| SMILES | CCC(CC)(OC)C(NC)c1sccc1Br |
| InChI | InChI=1S/C12H20BrNOS/c1-5-12(6-2,15-4)11(14-3)10-9(13)7-8-16-10/h7-8,11,14H,5-6H2,1-4H3 |
| InChIKey | IQMYYGGJLLMTFD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |