C15H24FNO — CID 116761268
N,2-diethyl-1-(2-fluorophenyl)-2-methoxybutan-1-amine (PubChem CID 116761268) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is N,2-diethyl-1-(2-fluorophenyl)-2-methoxybutan-1-amine.
| Compound Name | N,2-diethyl-1-(2-fluorophenyl)-2-methoxybutan-1-amine |
|---|---|
| PubChem CID | 116761268 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N,2-diethyl-1-(2-fluorophenyl)-2-methoxybutan-1-amine |
| SMILES | CCNC(c1ccccc1F)C(CC)(CC)OC |
| InChI | InChI=1S/C15H24FNO/c1-5-15(6-2,18-4)14(17-7-3)12-10-8-9-11-13(12)16/h8-11,14,17H,5-7H2,1-4H3 |
| InChIKey | FRLPIEUOJPRJFT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |