C12H23NO — CID 116761878
1-(1-ethoxycyclopentyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 116761878) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-(1-ethoxycyclopentyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(1-ethoxycyclopentyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 116761878 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-(1-ethoxycyclopentyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)C1(OCC)CCCC1 |
| InChI | InChI=1S/C12H23NO/c1-5-14-12(8-6-7-9-12)11(13-4)10(2)3/h11,13H,2,5-9H2,1,3-4H3 |
| InChIKey | NDFYJIREWMWAPV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|