C12H25NO — CID 116761985
1-(1-ethoxycyclopentyl)-N,2-dimethylpropan-1-amine (PubChem CID 116761985) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-(1-ethoxycyclopentyl)-N,2-dimethylpropan-1-amine.
| Compound Name | 1-(1-ethoxycyclopentyl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 116761985 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 1-(1-ethoxycyclopentyl)-N,2-dimethylpropan-1-amine |
| SMILES | CCOC1(C(NC)C(C)C)CCCC1 |
| InChI | InChI=1S/C12H25NO/c1-5-14-12(8-6-7-9-12)11(13-4)10(2)3/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | RRBHXRXJAGFBJE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |