About 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine
1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine (PubChem CID 116762989) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine |
| PubChem CID | 116762989 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine |
| SMILES | CCC(C)CC(NC)C1(OC)CCCCC1 |
| InChI | InChI=1S/C14H29NO/c1-5-12(2)11-13(15-3)14(16-4)9-7-6-8-10-14/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | FAPORGMRYFHXAS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine?
The IUPAC name of 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine (CID 116762989) is 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine.
What is the SMILES notation for 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine?
The canonical SMILES for 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine is CCC(C)CC(NC)C1(OC)CCCCC1.
What is the InChIKey of 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine?
The InChIKey is FAPORGMRYFHXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-5-12(2)11-13(15-3)14(16-4)9-7-6-8-10-14/h12-13,15H,5-11H2,1-4H3.
What are the key properties of 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine?
1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine has a molecular weight of 227.39 g/mol, XLogP of 3.36, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxycyclohexyl)-N,3-dimethylpentan-1-amine is sourced from PubChem (CID 116762989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).