C17H35NO — CID 116770390
N,3-diethyl-1-(1-methoxycycloheptyl)pentan-1-amine (PubChem CID 116770390) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is N,3-diethyl-1-(1-methoxycycloheptyl)pentan-1-amine.
| Compound Name | N,3-diethyl-1-(1-methoxycycloheptyl)pentan-1-amine |
|---|---|
| PubChem CID | 116770390 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | N,3-diethyl-1-(1-methoxycycloheptyl)pentan-1-amine |
| SMILES | CCNC(CC(CC)CC)C1(OC)CCCCCC1 |
| InChI | InChI=1S/C17H35NO/c1-5-15(6-2)14-16(18-7-3)17(19-4)12-10-8-9-11-13-17/h15-16,18H,5-14H2,1-4H3 |
| InChIKey | OMSNPOVDDWMLCN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |