C22H25NO6S — CID 11676363
(3R,5S)-5-benzoyl-3-(hydroxymethyl)-5-methoxy-3-(methylsulfanylmethoxy)-4-phenylmethoxypyrrolidin-2-one (PubChem CID 11676363) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is (3R,5S)-5-benzoyl-3-(hydroxymethyl)-5-methoxy-3-(methylsulfanylmethoxy)-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (3R,5S)-5-benzoyl-3-(hydroxymethyl)-5-methoxy-3-(methylsulfanylmethoxy)-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 11676363 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (3R,5S)-5-benzoyl-3-(hydroxymethyl)-5-methoxy-3-(methylsulfanylmethoxy)-4-phenylmethoxypyrrolidin-2-one |
| SMILES | CO[C@@]1(C(=O)c2ccccc2)NC(=O)[C@](CO)(OCSC)C1OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO6S/c1-27-22(18(25)17-11-7-4-8-12-17)19(28-13-16-9-5-3-6-10-16)21(14-24,20(26)23-22)29-15-30-2/h3-12,19,24H,13-15H2,1-2H3,(H,23,26)/t19?,21-,22-/m1/s1 |
| InChIKey | TYOWDJZBWGPIGD-CEAUUGKZSA-N |
| XLogP | 2.00 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|