C22H25NO7 — CID 44564636
(5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(Z,2R)-2-hydroxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione (PubChem CID 44564636) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is (5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(Z,2R)-2-hydroxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione.
| Compound Name | (5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(Z,2R)-2-hydroxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
|---|---|
| PubChem CID | 44564636 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (5S,8S,9R)-8-benzoyl-9-hydroxy-2-[(Z,2R)-2-hydroxyhex-3-enyl]-8-methoxy-3-methyl-1-oxa-7-azaspiro[4.4]non-2-ene-4,6-dione |
| SMILES | CC/C=C\[C@H](O)CC1=C(C)C(=O)[C@]2(O1)C(=O)N[C@@](OC)(C(=O)c1ccccc1)[C@@H]2O |
| InChI | InChI=1S/C22H25NO7/c1-4-5-11-15(24)12-16-13(2)17(25)21(30-16)19(27)22(29-3,23-20(21)28)18(26)14-9-7-6-8-10-14/h5-11,15,19,24,27H,4,12H2,1-3H3,(H,23,28)/b11-5-/t15-,19+,21+,22+/m0/s1 |
| InChIKey | ABVYJVMGGWAIQD-CDFZCAETSA-N |
| XLogP | 1.03 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|