C16H26ClNOS — CID 116764052
2-(5-chlorothiophen-2-yl)-1-(1-ethoxycyclohexyl)-N-ethylethanamine (PubChem CID 116764052) has the molecular formula C16H26ClNOS and a molecular weight of 315.91 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-(1-ethoxycyclohexyl)-N-ethylethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-(1-ethoxycyclohexyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 116764052 |
| Molecular Formula | C16H26ClNOS |
| Molecular Weight | 315.91 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-(1-ethoxycyclohexyl)-N-ethylethanamine |
| SMILES | CCNC(Cc1ccc(Cl)s1)C1(OCC)CCCCC1 |
| InChI | InChI=1S/C16H26ClNOS/c1-3-18-14(12-13-8-9-15(17)20-13)16(19-4-2)10-6-5-7-11-16/h8-9,14,18H,3-7,10-12H2,1-2H3 |
| InChIKey | UBSHIPDINOMHDJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |