C12H19ClN2O2S — CID 105276892
[(5-chlorothiophen-2-yl)-(4-ethoxyoxan-4-yl)methyl]hydrazine (PubChem CID 105276892) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is [(5-chlorothiophen-2-yl)-(4-ethoxyoxan-4-yl)methyl]hydrazine.
| Compound Name | [(5-chlorothiophen-2-yl)-(4-ethoxyoxan-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105276892 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [(5-chlorothiophen-2-yl)-(4-ethoxyoxan-4-yl)methyl]hydrazine |
| SMILES | CCOC1(C(NN)c2ccc(Cl)s2)CCOCC1 |
| InChI | InChI=1S/C12H19ClN2O2S/c1-2-17-12(5-7-16-8-6-12)11(15-14)9-3-4-10(13)18-9/h3-4,11,15H,2,5-8,14H2,1H3 |
| InChIKey | VWNWCUBEHKJPKU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|