C14H23ClN2S — CID 105328233
[(5-chlorothiophen-2-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]hydrazine (PubChem CID 105328233) has the molecular formula C14H23ClN2S and a molecular weight of 286.87 g/mol. Its IUPAC name is [(5-chlorothiophen-2-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]hydrazine.
| Compound Name | [(5-chlorothiophen-2-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]hydrazine |
|---|---|
| PubChem CID | 105328233 |
| Molecular Formula | C14H23ClN2S |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [(5-chlorothiophen-2-yl)-[1-(2-methylpropyl)cyclopentyl]methyl]hydrazine |
| SMILES | CC(C)CC1(C(NN)c2ccc(Cl)s2)CCCC1 |
| InChI | InChI=1S/C14H23ClN2S/c1-10(2)9-14(7-3-4-8-14)13(17-16)11-5-6-12(15)18-11/h5-6,10,13,17H,3-4,7-9,16H2,1-2H3 |
| InChIKey | GBGBTHSDCQFKOP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|