C15H25ClN2OS — CID 105277901
[(5-chlorothiophen-2-yl)-(1-ethoxy-4,4-dimethylcyclohexyl)methyl]hydrazine (PubChem CID 105277901) has the molecular formula C15H25ClN2OS and a molecular weight of 316.90 g/mol. Its IUPAC name is [(5-chlorothiophen-2-yl)-(1-ethoxy-4,4-dimethylcyclohexyl)methyl]hydrazine.
| Compound Name | [(5-chlorothiophen-2-yl)-(1-ethoxy-4,4-dimethylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105277901 |
| Molecular Formula | C15H25ClN2OS |
| Molecular Weight | 316.90 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(5-chlorothiophen-2-yl)-(1-ethoxy-4,4-dimethylcyclohexyl)methyl]hydrazine |
| SMILES | CCOC1(C(NN)c2ccc(Cl)s2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H25ClN2OS/c1-4-19-15(9-7-14(2,3)8-10-15)13(18-17)11-5-6-12(16)20-11/h5-6,13,18H,4,7-10,17H2,1-3H3 |
| InChIKey | AALUQVUPKREYRX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|