C14H24ClN3O2 — CID 116764431
2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(4-methoxyoxan-4-yl)ethanamine (PubChem CID 116764431) has the molecular formula C14H24ClN3O2 and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(4-methoxyoxan-4-yl)ethanamine.
| Compound Name | 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(4-methoxyoxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 116764431 |
| Molecular Formula | C14H24ClN3O2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-(4-chloro-1-ethyl-3-methylpyrazol-5-yl)-1-(4-methoxyoxan-4-yl)ethanamine |
| SMILES | CCn1nc(C)c(Cl)c1CC(N)C1(OC)CCOCC1 |
| InChI | InChI=1S/C14H24ClN3O2/c1-4-18-11(13(15)10(2)17-18)9-12(16)14(19-3)5-7-20-8-6-14/h12H,4-9,16H2,1-3H3 |
| InChIKey | GQMNPBWEJVUKPJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |