C10H19NO2 — CID 116764621
1-(4-methoxyoxan-4-yl)-N-methylprop-2-en-1-amine (PubChem CID 116764621) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(4-methoxyoxan-4-yl)-N-methylprop-2-en-1-amine.
| Compound Name | 1-(4-methoxyoxan-4-yl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 116764621 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(4-methoxyoxan-4-yl)-N-methylprop-2-en-1-amine |
| SMILES | C=CC(NC)C1(OC)CCOCC1 |
| InChI | InChI=1S/C10H19NO2/c1-4-9(11-2)10(12-3)5-7-13-8-6-10/h4,9,11H,1,5-8H2,2-3H3 |
| InChIKey | CIZRCSADCXVNBR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|