C14H24N2O2S — CID 116765952
1-(4-ethoxyoxan-4-yl)-N-ethyl-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 116765952) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 1-(4-ethoxyoxan-4-yl)-N-ethyl-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(4-ethoxyoxan-4-yl)-N-ethyl-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 116765952 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(4-ethoxyoxan-4-yl)-N-ethyl-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | CCNC(Cc1cncs1)C1(OCC)CCOCC1 |
| InChI | InChI=1S/C14H24N2O2S/c1-3-16-13(9-12-10-15-11-19-12)14(18-4-2)5-7-17-8-6-14/h10-11,13,16H,3-9H2,1-2H3 |
| InChIKey | REDXTKXRROWRCH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |