C16H31NO3S — CID 116766121
(1-methoxy-4-methylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 116766121) has the molecular formula C16H31NO3S and a molecular weight of 317.50 g/mol. Its IUPAC name is (1-methoxy-4-methylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | (1-methoxy-4-methylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 116766121 |
| Molecular Formula | C16H31NO3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (1-methoxy-4-methylcyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | COC1(C(N)C2CCCC(S(C)(=O)=O)C2)CCC(C)CC1 |
| InChI | InChI=1S/C16H31NO3S/c1-12-7-9-16(20-2,10-8-12)15(17)13-5-4-6-14(11-13)21(3,18)19/h12-15H,4-11,17H2,1-3H3 |
| InChIKey | PNBBPHIYLPEQLG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |