C17H29NOS — CID 116766820
N-[(1-methoxy-4-methylcyclohexyl)-(3-methylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 116766820) has the molecular formula C17H29NOS and a molecular weight of 295.49 g/mol. Its IUPAC name is N-[(1-methoxy-4-methylcyclohexyl)-(3-methylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(1-methoxy-4-methylcyclohexyl)-(3-methylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 116766820 |
| Molecular Formula | C17H29NOS |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | N-[(1-methoxy-4-methylcyclohexyl)-(3-methylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1sccc1C)C1(OC)CCC(C)CC1 |
| InChI | InChI=1S/C17H29NOS/c1-5-11-18-16(15-14(3)8-12-20-15)17(19-4)9-6-13(2)7-10-17/h8,12-13,16,18H,5-7,9-11H2,1-4H3 |
| InChIKey | ORMOLDZZWMAKMS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |