C15H21Cl2NO — CID 116767627
(3,4-dichlorophenyl)-(1-methoxy-3-methylcyclohexyl)methanamine (PubChem CID 116767627) has the molecular formula C15H21Cl2NO and a molecular weight of 302.25 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(1-methoxy-3-methylcyclohexyl)methanamine.
| Compound Name | (3,4-dichlorophenyl)-(1-methoxy-3-methylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 116767627 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (3,4-dichlorophenyl)-(1-methoxy-3-methylcyclohexyl)methanamine |
| SMILES | COC1(C(N)c2ccc(Cl)c(Cl)c2)CCCC(C)C1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-10-4-3-7-15(9-10,19-2)14(18)11-5-6-12(16)13(17)8-11/h5-6,8,10,14H,3-4,7,9,18H2,1-2H3 |
| InChIKey | JPVMIRDVCOEFIL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |