C20H24FN2O2S+ — CID 11676862
(8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-fluoro-6-thiophen-3-ylphenyl)carbamate (PubChem CID 11676862) has the molecular formula C20H24FN2O2S+ and a molecular weight of 375.49 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-fluoro-6-thiophen-3-ylphenyl)carbamate.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-fluoro-6-thiophen-3-ylphenyl)carbamate |
|---|---|
| PubChem CID | 11676862 |
| Molecular Formula | C20H24FN2O2S+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl) N-(2-fluoro-6-thiophen-3-ylphenyl)carbamate |
| SMILES | C[N+]1(C)C2CCC1CC(OC(=O)Nc1c(F)cccc1-c1ccsc1)C2 |
| InChI | InChI=1S/C20H23FN2O2S/c1-23(2)14-6-7-15(23)11-16(10-14)25-20(24)22-19-17(4-3-5-18(19)21)13-8-9-26-12-13/h3-5,8-9,12,14-16H,6-7,10-11H2,1-2H3/p+1 |
| InChIKey | CVZVAGSFEZBKMW-UHFFFAOYSA-O |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|