C23H32F2N6O2 — CID 11677002
tert-butyl 4-[[[6-(4-amino-2,5-difluoroanilino)pyrimidin-4-yl]-ethylamino]methyl]piperidine-1-carboxylate (PubChem CID 11677002) has the molecular formula C23H32F2N6O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is tert-butyl 4-[[[6-(4-amino-2,5-difluoroanilino)pyrimidin-4-yl]-ethylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[6-(4-amino-2,5-difluoroanilino)pyrimidin-4-yl]-ethylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11677002 |
| Molecular Formula | C23H32F2N6O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | tert-butyl 4-[[[6-(4-amino-2,5-difluoroanilino)pyrimidin-4-yl]-ethylamino]methyl]piperidine-1-carboxylate |
| SMILES | CCN(CC1CCN(C(=O)OC(C)(C)C)CC1)c1cc(Nc2cc(F)c(N)cc2F)ncn1 |
| InChI | InChI=1S/C23H32F2N6O2/c1-5-30(13-15-6-8-31(9-7-15)22(32)33-23(2,3)4)21-12-20(27-14-28-21)29-19-11-16(24)18(26)10-17(19)25/h10-12,14-15H,5-9,13,26H2,1-4H3,(H,27,28,29) |
| InChIKey | GKIVDSGNZWUJNO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|