C24H33F2N5O3 — CID 142780578
tert-butyl 4-[[2-[6-(2,5-difluoro-4-methoxyanilino)pyrimidin-4-yl]ethylamino]methyl]piperidine-1-carboxylate (PubChem CID 142780578) has the molecular formula C24H33F2N5O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is tert-butyl 4-[[2-[6-(2,5-difluoro-4-methoxyanilino)pyrimidin-4-yl]ethylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[6-(2,5-difluoro-4-methoxyanilino)pyrimidin-4-yl]ethylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142780578 |
| Molecular Formula | C24H33F2N5O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | tert-butyl 4-[[2-[6-(2,5-difluoro-4-methoxyanilino)pyrimidin-4-yl]ethylamino]methyl]piperidine-1-carboxylate |
| SMILES | COc1cc(F)c(Nc2cc(CCNCC3CCN(C(=O)OC(C)(C)C)CC3)ncn2)cc1F |
| InChI | InChI=1S/C24H33F2N5O3/c1-24(2,3)34-23(32)31-9-6-16(7-10-31)14-27-8-5-17-11-22(29-15-28-17)30-20-12-19(26)21(33-4)13-18(20)25/h11-13,15-16,27H,5-10,14H2,1-4H3,(H,28,29,30) |
| InChIKey | RSWFSWVABJAYIZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|