C16H27N3O2S — CID 103730250
tert-butyl 4-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidine-1-carboxylate (PubChem CID 103730250) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is tert-butyl 4-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103730250 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | tert-butyl 4-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNCCc2cscn2)CC1 |
| InChI | InChI=1S/C16H27N3O2S/c1-16(2,3)21-15(20)19-8-5-13(6-9-19)10-17-7-4-14-11-22-12-18-14/h11-13,17H,4-10H2,1-3H3 |
| InChIKey | LTLPQXPFXGARGK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|