C16H29N5O2 — CID 103761220
tert-butyl 4-[[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]piperidine-1-carboxylate (PubChem CID 103761220) has the molecular formula C16H29N5O2 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl 4-[[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103761220 |
| Molecular Formula | C16H29N5O2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | tert-butyl 4-[[2-(1-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]piperidine-1-carboxylate |
| SMILES | Cn1cnc(CCNCC2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C16H29N5O2/c1-16(2,3)23-15(22)21-9-6-13(7-10-21)11-17-8-5-14-18-12-20(4)19-14/h12-13,17H,5-11H2,1-4H3 |
| InChIKey | WFQDKUQDUQWOGN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|