C16H26BrNOS — CID 116771653
3-(5-bromothiophen-2-yl)-1-cyclohexyl-N-ethyl-1-methoxypropan-2-amine (PubChem CID 116771653) has the molecular formula C16H26BrNOS and a molecular weight of 360.36 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-1-cyclohexyl-N-ethyl-1-methoxypropan-2-amine.
| Compound Name | 3-(5-bromothiophen-2-yl)-1-cyclohexyl-N-ethyl-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 116771653 |
| Molecular Formula | C16H26BrNOS |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-1-cyclohexyl-N-ethyl-1-methoxypropan-2-amine |
| SMILES | CCNC(Cc1ccc(Br)s1)C(OC)C1CCCCC1 |
| InChI | InChI=1S/C16H26BrNOS/c1-3-18-14(11-13-9-10-15(17)20-13)16(19-2)12-7-5-4-6-8-12/h9-10,12,14,16,18H,3-8,11H2,1-2H3 |
| InChIKey | HHLMQMSBUKBPQL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |