C14H26F3NO — CID 116771700
1-cyclohexyl-N-ethyl-5,5,5-trifluoro-1-methoxypentan-2-amine (PubChem CID 116771700) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-cyclohexyl-N-ethyl-5,5,5-trifluoro-1-methoxypentan-2-amine.
| Compound Name | 1-cyclohexyl-N-ethyl-5,5,5-trifluoro-1-methoxypentan-2-amine |
|---|---|
| PubChem CID | 116771700 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-cyclohexyl-N-ethyl-5,5,5-trifluoro-1-methoxypentan-2-amine |
| SMILES | CCNC(CCC(F)(F)F)C(OC)C1CCCCC1 |
| InChI | InChI=1S/C14H26F3NO/c1-3-18-12(9-10-14(15,16)17)13(19-2)11-7-5-4-6-8-11/h11-13,18H,3-10H2,1-2H3 |
| InChIKey | YOSQYHNPYXOIQP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |