C23H29N5O5S — CID 11677513
N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-[methyl-(3-nitrophenyl)sulfonylamino]butanamide (PubChem CID 11677513) has the molecular formula C23H29N5O5S and a molecular weight of 487.58 g/mol. Its IUPAC name is N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-[methyl-(3-nitrophenyl)sulfonylamino]butanamide.
| Compound Name | N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-[methyl-(3-nitrophenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 11677513 |
| Molecular Formula | C23H29N5O5S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methyl-4-[methyl-(3-nitrophenyl)sulfonylamino]butanamide |
| SMILES | CN(CCc1ccc(C2=NCCN2)cc1)C(=O)CCCN(C)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H29N5O5S/c1-26(16-12-18-8-10-19(11-9-18)23-24-13-14-25-23)22(29)7-4-15-27(2)34(32,33)21-6-3-5-20(17-21)28(30)31/h3,5-6,8-11,17H,4,7,12-16H2,1-2H3,(H,24,25) |
| InChIKey | POMDWSKZZUBGAS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|