C23H28ClN5O5S — CID 11642154
4-[(4-chloro-3-nitrophenyl)sulfonyl-methylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide (PubChem CID 11642154) has the molecular formula C23H28ClN5O5S and a molecular weight of 522.03 g/mol. Its IUPAC name is 4-[(4-chloro-3-nitrophenyl)sulfonyl-methylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide.
| Compound Name | 4-[(4-chloro-3-nitrophenyl)sulfonyl-methylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 11642154 |
| Molecular Formula | C23H28ClN5O5S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 4-[(4-chloro-3-nitrophenyl)sulfonyl-methylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylbutanamide |
| SMILES | CN(CCc1ccc(C2=NCCN2)cc1)C(=O)CCCN(C)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28ClN5O5S/c1-27(15-11-17-5-7-18(8-6-17)23-25-12-13-26-23)22(30)4-3-14-28(2)35(33,34)19-9-10-20(24)21(16-19)29(31)32/h5-10,16H,3-4,11-15H2,1-2H3,(H,25,26) |
| InChIKey | QTZRSFPEKGTTKD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|