C24H27ClF3N5O7S — CID 69422184
3-[(4-chloro-3-nitrophenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 69422184) has the molecular formula C24H27ClF3N5O7S and a molecular weight of 622.02 g/mol. Its IUPAC name is 3-[(4-chloro-3-nitrophenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(4-chloro-3-nitrophenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69422184 |
| Molecular Formula | C24H27ClF3N5O7S |
| Molecular Weight | 622.02 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 3-[(4-chloro-3-nitrophenyl)sulfonylmethylamino]-N-[2-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]ethyl]-N-methylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(CCc1ccc(C2=NCCN2)cc1)C(=O)CCNCS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26ClN5O5S.C2HF3O2/c1-27(13-9-16-2-4-17(5-3-16)22-25-11-12-26-22)21(29)8-10-24-15-34(32,33)18-6-7-19(23)20(14-18)28(30)31;3-2(4,5)1(6)7/h2-7,14,24H,8-13,15H2,1H3,(H,25,26);(H,6,7) |
| InChIKey | DZYXSQACFRVQEG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.02 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|