C16H26N4O — CID 116777686
[2-(1-methoxycyclohexyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine (PubChem CID 116777686) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is [2-(1-methoxycyclohexyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(1-methoxycyclohexyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 116777686 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [2-(1-methoxycyclohexyl)-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
| SMILES | COC1(c2nc3c(c(NN)n2)CCCCC3)CCCCC1 |
| InChI | InChI=1S/C16H26N4O/c1-21-16(10-6-3-7-11-16)15-18-13-9-5-2-4-8-12(13)14(19-15)20-17/h2-11,17H2,1H3,(H,18,19,20) |
| InChIKey | YRKCKPCTIAQYDO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|