C13H20N4O2S — CID 116777758
[2-(4-ethoxyoxan-4-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 116777758) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is [2-(4-ethoxyoxan-4-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-ethoxyoxan-4-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 116777758 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [2-(4-ethoxyoxan-4-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | CCOC1(c2nc3c(c(NN)n2)CSC3)CCOCC1 |
| InChI | InChI=1S/C13H20N4O2S/c1-2-19-13(3-5-18-6-4-13)12-15-10-8-20-7-9(10)11(16-12)17-14/h2-8,14H2,1H3,(H,15,16,17) |
| InChIKey | ZBZQHVVERVVPMV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|