C15H23N3O2 — CID 116775670
2-(4-ethoxyoxan-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 116775670) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-(4-ethoxyoxan-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-(4-ethoxyoxan-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 116775670 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 2-(4-ethoxyoxan-4-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | CCOC1(c2nc(N)c3c(n2)CCCC3)CCOCC1 |
| InChI | InChI=1S/C15H23N3O2/c1-2-20-15(7-9-19-10-8-15)14-17-12-6-4-3-5-11(12)13(16)18-14/h2-10H2,1H3,(H2,16,17,18) |
| InChIKey | UMDLXNNRMFZUJS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |