C14H21N3O4 — CID 116782896
ethyl 4-amino-2-(4-ethoxyoxan-4-yl)pyrimidine-5-carboxylate (PubChem CID 116782896) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is ethyl 4-amino-2-(4-ethoxyoxan-4-yl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(4-ethoxyoxan-4-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 116782896 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | ethyl 4-amino-2-(4-ethoxyoxan-4-yl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C2(OCC)CCOCC2)nc1N |
| InChI | InChI=1S/C14H21N3O4/c1-3-20-12(18)10-9-16-13(17-11(10)15)14(21-4-2)5-7-19-8-6-14/h9H,3-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | WKFQMYMESHCHHH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |