C15H21ClO2S — CID 116779685
2-(2-chlorophenyl)sulfanyl-1-(1-methoxycyclohexyl)ethanol (PubChem CID 116779685) has the molecular formula C15H21ClO2S and a molecular weight of 300.85 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-1-(1-methoxycyclohexyl)ethanol.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-1-(1-methoxycyclohexyl)ethanol |
|---|---|
| PubChem CID | 116779685 |
| Molecular Formula | C15H21ClO2S |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-1-(1-methoxycyclohexyl)ethanol |
| SMILES | COC1(C(O)CSc2ccccc2Cl)CCCCC1 |
| InChI | InChI=1S/C15H21ClO2S/c1-18-15(9-5-2-6-10-15)14(17)11-19-13-8-4-3-7-12(13)16/h3-4,7-8,14,17H,2,5-6,9-11H2,1H3 |
| InChIKey | FFAYLBDXWMPUGL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |