About 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide
1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide (PubChem CID 116779982) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide.
Molecular Properties
| Compound Name | 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide |
| PubChem CID | 116779982 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide |
| SMILES | CCC/N=C(\N)C1(OC)CCCC(C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-4-8-14-11(13)12(15-3)7-5-6-10(2)9-12/h10H,4-9H2,1-3H3,(H2,13,14) |
| InChIKey | YAKSHGIDABDZTI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide?
The IUPAC name of 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide (CID 116779982) is 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide.
What is the SMILES notation for 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide?
The canonical SMILES for 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide is CCC/N=C(\N)C1(OC)CCCC(C)C1.
What is the InChIKey of 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide?
The InChIKey is YAKSHGIDABDZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-4-8-14-11(13)12(15-3)7-5-6-10(2)9-12/h10H,4-9H2,1-3H3,(H2,13,14).
What are the key properties of 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide?
1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide has a molecular weight of 212.34 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-methyl-N'-propylcyclohexane-1-carboximidamide is sourced from PubChem (CID 116779982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).