C16H20N2O3 — CID 116781675
[3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol (PubChem CID 116781675) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is [3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol.
| Compound Name | [3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol |
|---|---|
| PubChem CID | 116781675 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [3-(1-methoxycyclohexyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol |
| SMILES | COC1(c2noc(C(O)c3ccccc3)n2)CCCCC1 |
| InChI | InChI=1S/C16H20N2O3/c1-20-16(10-6-3-7-11-16)15-17-14(21-18-15)13(19)12-8-4-2-5-9-12/h2,4-5,8-9,13,19H,3,6-7,10-11H2,1H3 |
| InChIKey | IMTSZVFBNCGPJO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |