C10H10N2O2 — CID 63851603
(3-methyl-1,2,4-oxadiazol-5-yl)-phenylmethanol (PubChem CID 63851603) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl)-phenylmethanol.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl)-phenylmethanol |
|---|---|
| PubChem CID | 63851603 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl)-phenylmethanol |
| SMILES | Cc1noc(C(O)c2ccccc2)n1 |
| InChI | InChI=1S/C10H10N2O2/c1-7-11-10(14-12-7)9(13)8-5-3-2-4-6-8/h2-6,9,13H,1H3 |
| InChIKey | ASOQZCFXVZTJLT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |