C14H10ClN3O2 — CID 103445508
[3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol (PubChem CID 103445508) has the molecular formula C14H10ClN3O2 and a molecular weight of 287.71 g/mol. Its IUPAC name is [3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol.
| Compound Name | [3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol |
|---|---|
| PubChem CID | 103445508 |
| Molecular Formula | C14H10ClN3O2 |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | [3-(3-chloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]-phenylmethanol |
| SMILES | OC(c1ccccc1)c1nc(-c2ncccc2Cl)no1 |
| InChI | InChI=1S/C14H10ClN3O2/c15-10-7-4-8-16-11(10)13-17-14(20-18-13)12(19)9-5-2-1-3-6-9/h1-8,12,19H |
| InChIKey | VLZMKRXVTYECQQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |