About phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol
phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol (PubChem CID 63850087) has the molecular formula C14H11N3O2
and a molecular weight of 253.26 g/mol. Its IUPAC name is phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol.
Molecular Properties
| Compound Name | phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol |
| PubChem CID | 63850087 |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol |
| SMILES | OC(c1ccccc1)c1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C14H11N3O2/c18-12(10-4-2-1-3-5-10)14-16-13(17-19-14)11-6-8-15-9-7-11/h1-9,12,18H |
| InChIKey | BPGRKBXGNDFPNM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol?
The IUPAC name of phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol (CID 63850087) is phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol.
What is the SMILES notation for phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol?
The canonical SMILES for phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol is OC(c1ccccc1)c1nc(-c2ccncc2)no1.
What is the InChIKey of phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol?
The InChIKey is BPGRKBXGNDFPNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O2/c18-12(10-4-2-1-3-5-10)14-16-13(17-19-14)11-6-8-15-9-7-11/h1-9,12,18H.
What are the key properties of phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol?
phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol has a molecular weight of 253.26 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)methanol is sourced from PubChem (CID 63850087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).