C13H10BrN5 — CID 116783115
4-N-(3-bromoquinolin-8-yl)pyrimidine-4,5-diamine (PubChem CID 116783115) has the molecular formula C13H10BrN5 and a molecular weight of 316.16 g/mol. Its IUPAC name is 4-N-(3-bromoquinolin-8-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(3-bromoquinolin-8-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 116783115 |
| Molecular Formula | C13H10BrN5 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 4-N-(3-bromoquinolin-8-yl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1Nc1cccc2cc(Br)cnc12 |
| InChI | InChI=1S/C13H10BrN5/c14-9-4-8-2-1-3-11(12(8)17-5-9)19-13-10(15)6-16-7-18-13/h1-7H,15H2,(H,16,18,19) |
| InChIKey | LWPPXECXGMSULQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |