C17H24ClN3 — CID 116783677
2-N-(5-chloroquinolin-8-yl)octane-1,2-diamine (PubChem CID 116783677) has the molecular formula C17H24ClN3 and a molecular weight of 305.85 g/mol. Its IUPAC name is 2-N-(5-chloroquinolin-8-yl)octane-1,2-diamine.
| Compound Name | 2-N-(5-chloroquinolin-8-yl)octane-1,2-diamine |
|---|---|
| PubChem CID | 116783677 |
| Molecular Formula | C17H24ClN3 |
| Molecular Weight | 305.85 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-N-(5-chloroquinolin-8-yl)octane-1,2-diamine |
| SMILES | CCCCCCC(CN)Nc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C17H24ClN3/c1-2-3-4-5-7-13(12-19)21-16-10-9-15(18)14-8-6-11-20-17(14)16/h6,8-11,13,21H,2-5,7,12,19H2,1H3 |
| InChIKey | OBHOLZKEPHCDFH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|