C15H18BrN3O2 — CID 116784369
2-amino-N-(3-bromoquinolin-8-yl)-5-methoxypentanamide (PubChem CID 116784369) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-amino-N-(3-bromoquinolin-8-yl)-5-methoxypentanamide.
| Compound Name | 2-amino-N-(3-bromoquinolin-8-yl)-5-methoxypentanamide |
|---|---|
| PubChem CID | 116784369 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-amino-N-(3-bromoquinolin-8-yl)-5-methoxypentanamide |
| SMILES | COCCCC(N)C(=O)Nc1cccc2cc(Br)cnc12 |
| InChI | InChI=1S/C15H18BrN3O2/c1-21-7-3-5-12(17)15(20)19-13-6-2-4-10-8-11(16)9-18-14(10)13/h2,4,6,8-9,12H,3,5,7,17H2,1H3,(H,19,20) |
| InChIKey | PWNHBESDBJIHQY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|