C14H16BrN3OS — CID 104909142
(2R)-2-amino-N-(3-bromoquinolin-8-yl)-4-methylsulfanylbutanamide (PubChem CID 104909142) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is (2R)-2-amino-N-(3-bromoquinolin-8-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(3-bromoquinolin-8-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104909142 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (2R)-2-amino-N-(3-bromoquinolin-8-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)Nc1cccc2cc(Br)cnc12 |
| InChI | InChI=1S/C14H16BrN3OS/c1-20-6-5-11(16)14(19)18-12-4-2-3-9-7-10(15)8-17-13(9)12/h2-4,7-8,11H,5-6,16H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | HZVIOTLNSBMKTJ-LLVKDONJSA-N |
| XLogP | 3.02 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |