C8H7N5OS — CID 116786705
2-amino-N-pyridazin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 116786705) has the molecular formula C8H7N5OS and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-amino-N-pyridazin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-pyridazin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 116786705 |
| Molecular Formula | C8H7N5OS |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-amino-N-pyridazin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2cccnn2)cs1 |
| InChI | InChI=1S/C8H7N5OS/c9-8-11-5(4-15-8)7(14)12-6-2-1-3-10-13-6/h1-4H,(H2,9,11)(H,12,13,14) |
| InChIKey | IKIGITKYEXPTMR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |