C14H11N5OS — CID 141488082
2-amino-N-(6-phenylpyrazin-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 141488082) has the molecular formula C14H11N5OS and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-amino-N-(6-phenylpyrazin-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-(6-phenylpyrazin-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 141488082 |
| Molecular Formula | C14H11N5OS |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-amino-N-(6-phenylpyrazin-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)Nc2cncc(-c3ccccc3)n2)cs1 |
| InChI | InChI=1S/C14H11N5OS/c15-14-18-11(8-21-14)13(20)19-12-7-16-6-10(17-12)9-4-2-1-3-5-9/h1-8H,(H2,15,18)(H,17,19,20) |
| InChIKey | LGTKKPSZWQQRFQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |